3-Bromo-5-(trifluoromethyl)-7-azaindole structure
|
Common Name | 3-Bromo-5-(trifluoromethyl)-7-azaindole | ||
|---|---|---|---|---|
| CAS Number | 1048914-10-8 | Molecular Weight | 265.030 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H4BrF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Bromo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C8H4BrF3N2 |
| Molecular Weight | 265.030 |
| Exact Mass | 263.950989 |
| PSA | 28.68000 |
| LogP | 3.77 |
| Index of Refraction | 1.596 |
| InChIKey | VIYSXRUBYNGMDZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cnc2[nH]cc(Br)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Bromo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| 3-Bromo-5-(trifluoromethyl)-7-azaindole |
| 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-5-(trifluoromethyl)- |
| bromotrifluoromethylpyrrolobpyridine |