1-(2,4-dichlorophenoxy)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol structure
|
Common Name | 1-(2,4-dichlorophenoxy)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 104970-08-3 | Molecular Weight | 400.29600 | |
| Density | 1.255g/cm3 | Boiling Point | 553.8ºC at 760mmHg | |
| Molecular Formula | C19H23Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.7ºC | |
| Name | 1-(2,4-dichlorophenoxy)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 553.8ºC at 760mmHg |
| Molecular Formula | C19H23Cl2NO4 |
| Molecular Weight | 400.29600 |
| Flash Point | 288.7ºC |
| Exact Mass | 399.10000 |
| PSA | 59.95000 |
| LogP | 3.97350 |
| Vapour Pressure | 4.23E-13mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | LHWFDNGVDKNZDS-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNCC(O)COc2ccc(Cl)cc2Cl)cc1OC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(2,4-Dichlorophenoxy)-3-((2-(3,4-dimethoxyphenyl)ethyl)amino)-2-propanol |
| B 24-76 |
| DL-1-(2,4-Dichlor-phenoxy)-3-<2-(3,4-dimethoxyphenyl)-ethylamino>propan-2-ol |
| 2-Propanol,1-(2,4-dichlorophenoxy)-3-[[2-(3,4-dimethoxyphenyl)ethyl]amino] |