5-hydroxy-2,2,6,6-tetramethyl-4-(3-phenylpropanoyl)cyclohex-4-ene-1,3-dione structure
|
Common Name | 5-hydroxy-2,2,6,6-tetramethyl-4-(3-phenylpropanoyl)cyclohex-4-ene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 10499-26-0 | Molecular Weight | 314.37600 | |
| Density | 1.16g/cm3 | Boiling Point | 481.1ºC at 760mmHg | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.9ºC | |
| Name | 5-hydroxy-2,2,6,6-tetramethyl-4-(3-phenylpropanoyl)cyclohex-4-ene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 481.1ºC at 760mmHg |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.37600 |
| Flash Point | 258.9ºC |
| Exact Mass | 314.15200 |
| PSA | 71.44000 |
| LogP | 3.20460 |
| Vapour Pressure | 4.57E-10mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | KUWGTESSHWPSOB-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=O)C(C(=O)CCc2ccccc2)=C(O)C(C)(C)C1=O |
|
~%
5-hydroxy-2,2,6... CAS#:10499-26-0 |
| Literature: Van Klink, John W.; Brophy, Joseph J.; Perry, Nigel B.; Weavers, Rex T. Journal of Natural Products, 1999 , vol. 62, # 3 p. 487 - 489 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Grandiflorone |