1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one structure
|
Common Name | 1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 1050-79-9 | Molecular Weight | 355.44600 | |
| Density | 1.155g/cm3 | Boiling Point | 517.7ºC at 760mmHg | |
| Molecular Formula | C22H26FNO2 | Melting Point | 118-119ºC | |
| MSDS | N/A | Flash Point | 266.9ºC | |
| Name | 1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 517.7ºC at 760mmHg |
| Melting Point | 118-119ºC |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.44600 |
| Flash Point | 266.9ºC |
| Exact Mass | 355.19500 |
| PSA | 40.54000 |
| LogP | 4.01850 |
| Vapour Pressure | 1.52E-11mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | AGAHNABIDCTLHW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2(O)CCN(CCCC(=O)c3ccc(F)cc3)CC2)cc1 |
| HS Code | 2933399090 |
|---|
|
~%
1-(4-fluorophen... CAS#:1050-79-9 |
| Literature: Journal of Medicinal and Pharmaceutical Chemistry, , vol. 1, p. 281,284 |
|
~%
1-(4-fluorophen... CAS#:1050-79-9 |
| Literature: Journal of Medicinal and Pharmaceutical Chemistry, , vol. 1, p. 281,284 |
|
~%
1-(4-fluorophen... CAS#:1050-79-9 |
| Literature: Journal of Medicinal and Pharmaceutical Chemistry, , vol. 1, p. 281,284 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-fluoro-phenyl)-4-(4-hydroxy-4-p-tolyl-piperidino)-butan-1-one |
| Moperone [INN] |
| fluoro-4'(hydroxy-4 p-tolyl-4 piperidino)-4 butyrophenone |
| Methylperidol |
| 1-(4-fluoro-phenyl)-4-(4-hydroxy-4-p-tolyl-piperidin-1-yl)-butan-1-one |
| Luvatren |
| Moperone HCl |
| Meperon |
| Moperone |
| Luvatrena |