N-[(4-hydroxy-3-methoxyphenyl)methyl]-3-phenylpropanamide structure
|
Common Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-3-phenylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 105026-90-2 | Molecular Weight | 285.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO3 |
|---|---|
| Molecular Weight | 285.33800 |
| Exact Mass | 285.13600 |
| PSA | 62.05000 |
| LogP | 3.49010 |
| InChIKey | DVHUTNUTHHXIPJ-UHFFFAOYSA-N |
| SMILES | COc1cc(CNC(=O)CCc2ccccc2)ccc1O |
|
~%
N-[(4-hydroxy-3... CAS#:105026-90-2 |
| Literature: Jones; Pyman Journal of the Chemical Society, 1925 , vol. 127, p. 2597 |
|
~%
N-[(4-hydroxy-3... CAS#:105026-90-2 |
| Literature: Jones; Pyman Journal of the Chemical Society, 1925 , vol. 127, p. 2597 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Hydrozimtsaeure-vanillylamid |
| 3-Phenyl-propionsaeure-vanillylamid |
| 3-phenyl-propionic acid vanillylamide |