bis(1,2,2-trichloroethenyl)mercury structure
|
Common Name | bis(1,2,2-trichloroethenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 10507-38-7 | Molecular Weight | 461.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4Cl6Hg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(1,2,2-trichloroethenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4Cl6Hg |
|---|---|
| Molecular Weight | 461.35100 |
| Exact Mass | 459.78400 |
| LogP | 4.75490 |
| InChIKey | RIPLALIEIHZWKT-UHFFFAOYSA-N |
| SMILES | ClC(Cl)=C(Cl)[Hg]C(Cl)=C(Cl)Cl |
| HS Code | 2931900090 |
|---|
|
~%
bis(1,2,2-trich... CAS#:10507-38-7 |
| Literature: Hofmann,K.A.; Kirmreuther Chemische Berichte, 1908 , vol. 41, p. 314 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Mercuritrichloraethylenid |
| Bis-trichlorvinyl-quecksilber |
| Bis(trichlorovinyl)quecksilberchlorid |
| Mercury,bis(trichloroethenyl) |
| bis(trichloroethenyl)mercury |
| Mercury,bis(trichloroethenyl)-(9CI) |
| Quecksilber-bis-trichloraethylenid |
| bis-trichlorovinyl-mercury |
| Mercury,bis(trichlorovinyl)-(7CI,8CI) |