Sodium 3-(cyclohexylamino)-1-propanesulfonate structure
|
Common Name | Sodium 3-(cyclohexylamino)-1-propanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 105140-23-6 | Molecular Weight | 243.299 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18NNaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,3-(cyclohexylamino)propane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H18NNaO3S |
|---|---|
| Molecular Weight | 243.299 |
| Exact Mass | 243.090515 |
| PSA | 77.61000 |
| LogP | 2.31570 |
| Appearance of Characters | NA |
| InChIKey | ZFIDLTODXGXBFM-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])CCCNC1CCCCC1.[Na+] |
| Storage condition | Store at RT. |
| HS Code | 2921300090 |
|---|
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| BIC1468 |
| 3-Cyclohexylamino-1-propanesulfonic acid sodium salt |
| 1-Propanesulfonic acid, 3-(cyclohexylamino)-, sodium salt (1:1) |
| Sodium 3-(cyclohexylamino)-1-propanesulfonate |