1-ethenylpyrrolidin-2-one,1-ethenyl-1,2,4-triazol-3-amine structure
|
Common Name | 1-ethenylpyrrolidin-2-one,1-ethenyl-1,2,4-triazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 105219-24-7 | Molecular Weight | 221.25900 | |
| Density | N/A | Boiling Point | 217.6ºC at 760 mmHg | |
| Molecular Formula | C10H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.9ºC | |
| Name | 1-ethenylpyrrolidin-2-one,1-ethenyl-1,2,4-triazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 217.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.25900 |
| Flash Point | 93.9ºC |
| Exact Mass | 221.12800 |
| PSA | 77.77000 |
| LogP | 0.58110 |
| Vapour Pressure | 0.132mmHg at 25°C |
| InChIKey | ZUSWKCZVJHXQPD-UHFFFAOYSA-N |
| SMILES | C=CN1CCCC1=O.C=Cn1cnc(N)n1 |
| 1H-1,2,4-Triazol-3-amine,1-ethenyl-,polymer with 1-ethenyl-2-pyrrolidinone |
| 2-Pyrrolidinone,1-ethenyl-,polymer with 1-ethenyl-1H-1,2,4-triazol-3-amine |