dihydrotetramethylrosamine structure
|
Common Name | dihydrotetramethylrosamine | ||
|---|---|---|---|---|
| CAS Number | 105284-17-1 | Molecular Weight | 344.45 | |
| Density | 1.158g/cm3 | Boiling Point | 491.9ºC at 760mmHg | |
| Molecular Formula | C23H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.4ºC | |
Use of dihydrotetramethylrosamineDihydrotetramethylrosamine (DHTM Ros) is a fluorogenic substrate for peroxidase that oxidizes to fluorescent tetramethylrosamine chloride. |
| Name | 3-N,3-N,6-N,6-N-tetramethyl-9-phenyl-9H-xanthene-3,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Description | Dihydrotetramethylrosamine (DHTM Ros) is a fluorogenic substrate for peroxidase that oxidizes to fluorescent tetramethylrosamine chloride. |
|---|---|
| Related Catalog |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 491.9ºC at 760mmHg |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.45 |
| Flash Point | 140.4ºC |
| Exact Mass | 344.18900 |
| PSA | 15.71000 |
| LogP | 5.10450 |
| Vapour Pressure | 8.04E-10mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | PALQHVVMLBWIDW-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C2c1ccccc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9H-Xanthene-3,6-diamine,N,N,N',N'-tetramethyl-9-phenyl |
| Dihydrotetramethylrosamine |
| Dhtm ros |
| 3,6-bis-dimethylamino-9-phenyl-xanthene |