Cyclobutene, 1,2,3,3,4-pentafluoro-4-(trifluoromethyl)- structure
|
Common Name | Cyclobutene, 1,2,3,3,4-pentafluoro-4-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 105311-66-8 | Molecular Weight | 212.04100 | |
| Density | 1.64g/cm3 | Boiling Point | 20.3ºC at 760mmHg | |
| Molecular Formula | C5F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,3,4-pentafluoro-4-(trifluoromethyl)cyclobutene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 20.3ºC at 760mmHg |
| Molecular Formula | C5F8 |
| Molecular Weight | 212.04100 |
| Exact Mass | 211.98700 |
| LogP | 3.05650 |
| Vapour Pressure | 898mmHg at 25°C |
| Index of Refraction | 1.292 |
| InChIKey | XTLSITUJHHOIFO-UHFFFAOYSA-N |
| SMILES | FC1=C(F)C(F)(C(F)(F)F)C1(F)F |
| HS Code | 2903890090 |
|---|
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| perfluoro-3-methylcyclobutene |
| Octafluor-3-methyl-cyclobuten |