4-(2,4-DICHLORO-PHENYL)-2,4-DIOXO-BUTYRIC ACID structure
|
Common Name | 4-(2,4-DICHLORO-PHENYL)-2,4-DIOXO-BUTYRIC ACID | ||
|---|---|---|---|---|
| CAS Number | 105356-70-5 | Molecular Weight | 261.05800 | |
| Density | 1.539g/cm3 | Boiling Point | 408.4ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | 4-(2,4-dichlorophenyl)-2,4-dioxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 408.4ºC at 760 mmHg |
| Molecular Formula | C10H6Cl2O4 |
| Molecular Weight | 261.05800 |
| Flash Point | 200.8ºC |
| Exact Mass | 259.96400 |
| PSA | 71.44000 |
| LogP | 2.21990 |
| Vapour Pressure | 2.11E-07mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | RKFICNZDWSKKRL-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(Cl)cc1Cl |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| GL-0234 |
| 4-(2,4-Dichloro-phenyl)-2,4-dioxo-butyric acid |