4-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)-THIAZOL-2-YLAMINE structure
|
Common Name | 4-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)-THIAZOL-2-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 105362-06-9 | Molecular Weight | 234.27400 | |
| Density | 1.389g/cm3 | Boiling Point | 444.8ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine |
|---|
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.27400 |
| Flash Point | 222.8ºC |
| Exact Mass | 234.04600 |
| PSA | 85.61000 |
| LogP | 2.74470 |
| Vapour Pressure | 4.15E-08mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | QNDNSJKGUGRQDK-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc3c(c2)OCCO3)cs1 |
| HS Code | 2934100090 |
|---|
|
~%
4-(2,3-DIHYDRO-... CAS#:105362-06-9 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 36, # 9 p. 1391 - 1393 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |