3-[chloro(dimethyl)silyl]benzoyl chloride structure
|
Common Name | 3-[chloro(dimethyl)silyl]benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 105410-04-6 | Molecular Weight | 233.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10Cl2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[chloro(dimethyl)silyl]benzoyl chloride |
|---|
| Molecular Formula | C9H10Cl2OSi |
|---|---|
| Molecular Weight | 233.16700 |
| Exact Mass | 231.98800 |
| PSA | 17.07000 |
| LogP | 2.71650 |
| InChIKey | LBTCBJBNDBKEHU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)c1cccc(C(=O)Cl)c1 |
|
~59%
3-[chloro(dimet... CAS#:105410-04-6 |
| Literature: Rich, Jonathan D. Journal of the American Chemical Society, 1989 , vol. 111, # 15 p. 5886 - 5893 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |