5-Methoxy-7-nitro-1H-indole structure
|
Common Name | 5-Methoxy-7-nitro-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 10553-10-3 | Molecular Weight | 192.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 409.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5±23.2 °C | |
| Name | 5-Methoxy-7-nitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.5±25.0 °C at 760 mmHg |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.171 |
| Flash Point | 201.5±23.2 °C |
| Exact Mass | 192.053497 |
| PSA | 70.84000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | XNGPVHABLSIDPD-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c2[nH]ccc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Nitro-5-methoxy-indol |
| Indole,5-methoxy-7-nitro-(7CI,8CI) |
| 5-Methoxy-7-nitroindole |
| 1H-Indole, 5-methoxy-7-nitro- |
| 5-Methoxy-7-nitro-1H-indole |
| 1H-Indole,5-methoxy-7-nitro |