2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate
Modify Date: 2026-07-16 13:40:42
![2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/291/1055331-75-3.png)
2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate structure
|
Common Name | 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1055331-75-3 | Molecular Weight | 336.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14F2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14F2N2O4 |
|---|---|
| Molecular Weight | 336.29 |
| InChIKey | XYVYEVNELFGIEA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(F)cc(N)c1-c1c(N)cc(F)cc1C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate? |
| A: Molecular formula of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate is C16H14F2N2O4. |
| Q: What is the Chinese name of 1055331-75-3? |
| A: Chinese name of 1055331-75-3 is 1055331-75-3. |
| Q: What is the CAS number of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate? |
| A: CAS number of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate is 1055331-75-3. |
| Q: What is the English name of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate? |
| A: The English name of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate is 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate. |
| Q: What is the SMILES notation of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate? |
| A: SMILES notation of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate is COC(=O)c1cc(F)cc(N)c1-c1c(N)cc(F)cc1C(=O)OC. |
| Q: What is the InChIKey of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate? |
| A: InChIKey of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate is XYVYEVNELFGIEA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate? |
| A: Molecular weight of 2,2a(2)-Dimethyl 6,6a(2)-diamino-4,4a(2)-difluoro[1,1a(2)-biphenyl]-2,2a(2)-dicarboxylate is 336.29. |