6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione
Modify Date: 2025-09-23 19:27:16
![6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione Structure](https://www.chemsrc.com/extcaspic/054/10555-36-9.png)
6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione structure
|
Common Name | 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione | ||
|---|---|---|---|---|
| CAS Number | 10555-36-9 | Molecular Weight | 188.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8O3 |
|---|---|
| Molecular Weight | 188.18 |
| InChIKey | LDFCPMLSHWZWHS-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C23C4C5CC(C6C5C162)C43 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione? |
| A: The English name of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione is 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione. |
| Q: What is the InChIKey of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione? |
| A: InChIKey of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione is LDFCPMLSHWZWHS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione? |
| A: Molecular formula of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione is C11H8O3. |
| Q: What is the Chinese name of 10555-36-9? |
| A: Chinese name of 10555-36-9 is 10555-36-9. |
| Q: What is the molecular weight of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione? |
| A: Molecular weight of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione is 188.18. |
| Q: What is the CAS number of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione? |
| A: CAS number of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione is 10555-36-9. |
| Q: What is the SMILES notation of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione? |
| A: SMILES notation of 6-Oxahexacyclo[7.3.0.0~2,4~.0~3,11~.0~4,8~.0~8,10~]dodecane-5,7-dione is O=C1OC(=O)C23C4C5CC(C6C5C162)C43. |