6,6-dimethyl-4-phenylheptane-2,5-dione structure
|
Common Name | 6,6-dimethyl-4-phenylheptane-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 105592-04-9 | Molecular Weight | 232.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,6-dimethyl-4-phenylheptane-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20O2 |
|---|---|
| Molecular Weight | 232.31800 |
| Exact Mass | 232.14600 |
| PSA | 34.14000 |
| LogP | 3.36450 |
| InChIKey | LYXJEEMNWUCCRW-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C(=O)C(C)(C)C)c1ccccc1 |
|
~16%
6,6-dimethyl-4-... CAS#:105592-04-9 |
| Literature: Kitahara, Haruo; Tozawa, Yasuyuki; Fujita, Seikou; Tajiri, Akio; Morita, Noboru; Asao, Toyonobu Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 9 p. 3362 - 3364 |
|
~%
6,6-dimethyl-4-... CAS#:105592-04-9 |
| Literature: Seyfert, Dietmar; Hui, Richard C. Tetrahedron Letters, 1986 , vol. 27, # 13 p. 1473 - 1476 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-Heptanedione,6,6-dimethyl-4-phenyl |