2-[[2-acetyl-7-[(4-chlorophenyl)methoxy]-1-benzofuran-4-yl]sulfonyl-[(4-chlorophenyl)methyl]amino]acetic acid structure
|
Common Name | 2-[[2-acetyl-7-[(4-chlorophenyl)methoxy]-1-benzofuran-4-yl]sulfonyl-[(4-chlorophenyl)methyl]amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 105627-73-4 | Molecular Weight | 562.41800 | |
| Density | 1.465g/cm3 | Boiling Point | 750.9ºC at 760mmHg | |
| Molecular Formula | C26H21Cl2NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 407.9ºC | |
| Name | 2-[[2-acetyl-7-[(4-chlorophenyl)methoxy]-1-benzofuran-4-yl]sulfonyl-[(4-chlorophenyl)methyl]amino]acetic acid |
|---|
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 750.9ºC at 760mmHg |
| Molecular Formula | C26H21Cl2NO7S |
| Molecular Weight | 562.41800 |
| Flash Point | 407.9ºC |
| Exact Mass | 561.04200 |
| PSA | 122.50000 |
| LogP | 6.87750 |
| Vapour Pressure | 1.09E-23mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | SPEGYSDDNCIUBT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc2c(S(=O)(=O)N(CC(=O)O)Cc3ccc(Cl)cc3)ccc(OCc3ccc(Cl)cc3)c2o1 |
|
~%
2-[[2-acetyl-7-... CAS#:105627-73-4 |
| Literature: Ohishi; Mukai; Nagahara; Yajima; Kajikawa Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 9 p. 2398 - 2405 |
|
~%
2-[[2-acetyl-7-... CAS#:105627-73-4 |
| Literature: Ohishi; Mukai; Nagahara; Yajima; Kajikawa Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 9 p. 2398 - 2405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |