2-(p-Nitrophenyl)acetoacetic acid ethyl ester structure
|
Common Name | 2-(p-Nitrophenyl)acetoacetic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 10565-18-1 | Molecular Weight | 251.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(4-nitrophenyl)-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO5 |
|---|---|
| Molecular Weight | 251.23500 |
| Exact Mass | 251.07900 |
| PSA | 89.19000 |
| LogP | 2.35370 |
| InChIKey | CWLKTUNTDCJRIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| .α-(p-Nitrophenyl)acetessigsaeureaethylester |
| .3-Oxo-2-(4-nitro-phenyl)-buttersaeure-aethylester |
| .3-Oxo-2-[4-nitro-phenyl]-buttersaeure-aethylester |
| ethyl 2-(4-nitrophenyl)-3-oxobutanoate |