Methyl 4-amino-3-bromo-5-nitrobenzenecarboxylate structure
|
Common Name | Methyl 4-amino-3-bromo-5-nitrobenzenecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 105655-17-2 | Molecular Weight | 275.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-amino-3-bromo-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7BrN2O4 |
|---|---|
| Molecular Weight | 275.05600 |
| Exact Mass | 273.95900 |
| PSA | 98.14000 |
| LogP | 2.83050 |
| InChIKey | PRTLMEWWYBJZPN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)c(N)c([N+](=O)[O-])c1 |
| HS Code | 2922499990 |
|---|
|
~99%
Methyl 4-amino-... CAS#:105655-17-2 |
| Literature: Charrier, Nicolas; Demont, Emmanuel; Dunsdon, Rachel; Maile, Graham; Naylor, Alan; O'Brien, Alistair; Redshaw, Sally; Theobald, Pam; Vesey, David; Walter, Daryl Synlett, 2005 , # 20 art. no. D23305ST, p. 3071 - 3074 |
|
~%
Methyl 4-amino-... CAS#:105655-17-2 |
| Literature: WO2010/111058 A1, ; Page/Page column 88 ; WO 2010/111058 A1 |
|
~%
Methyl 4-amino-... CAS#:105655-17-2 |
| Literature: Synthesis, , # 20 p. 3467 - 3477 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methylaminobromonitrobenzenecarboxylate |
| Benzoic acid,4-amino-3-bromo-5-nitro-,methyl ester |