benzene-1,3-dicarboxylic acid,propane-1,3-diol,terephthalic acid structure
|
Common Name | benzene-1,3-dicarboxylic acid,propane-1,3-diol,terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 105726-60-1 | Molecular Weight | 408.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzene-1,3-dicarboxylic acid,propane-1,3-diol,terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O10 |
|---|---|
| Molecular Weight | 408.35600 |
| Exact Mass | 408.10600 |
| PSA | 189.66000 |
| LogP | 1.52710 |
| InChIKey | ACGGXLCHUZKCTB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.O=C(O)c1cccc(C(=O)O)c1.OCCCO |
| 1,3-Benzenedicarboxylic acid,polymer with 1,4-benzenedicarboxylic acid and 1,3-propanediol |