Brassinin structure
|
Common Name | Brassinin | ||
|---|---|---|---|---|
| CAS Number | 105748-59-2 | Molecular Weight | 236.36 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 436.9±47.0 °C at 760 mmHg | |
| Molecular Formula | C11H12N2S2 | Melting Point | 132-133ºC | |
| MSDS | N/A | Flash Point | 218.0±29.3 °C | |
Use of BrassininBrassinin is the metabolism of a phytoalexin from Brassica species[1]. |
| Name | brassinin |
|---|---|
| Synonym | More Synonyms |
| Description | Brassinin is the metabolism of a phytoalexin from Brassica species[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.9±47.0 °C at 760 mmHg |
| Melting Point | 132-133ºC |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.36 |
| Flash Point | 218.0±29.3 °C |
| Exact Mass | 236.044189 |
| PSA | 85.21000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | QYKQWFZDEDFELK-UHFFFAOYSA-N |
| SMILES | CSC(=S)NCc1c[nH]c2ccccc12 |
| Storage condition | -20°C |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Brassinin |
| Brassinine |
| Methyl (1H-indol-3-ylmethyl)carbamodithioate |
| UPCMLD-DP058 |
| Brassinin,1 |
| methyl N-(1H-indol-3-ylmethyl)carbamodithioate |
| Carbamodithioic acid, N-(1H-indol-3-ylmethyl)-, methyl ester |