dihexyl 9-ethylcarbazole-3,6-dicarboxylate structure
|
Common Name | dihexyl 9-ethylcarbazole-3,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 105769-77-5 | Molecular Weight | 451.59800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H37NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dihexyl 9-ethylcarbazole-3,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H37NO4 |
|---|---|
| Molecular Weight | 451.59800 |
| Exact Mass | 451.27200 |
| PSA | 57.53000 |
| LogP | 7.28860 |
| InChIKey | TWIAKTLOXGFCSK-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)c1ccc2c(c1)c1cc(C(=O)OCCCCCC)ccc1n2CC |
|
~%
dihexyl 9-ethyl... CAS#:105769-77-5 |
| Literature: Domanski, Andrzej; Kyziol, Janusz B. Polish Journal of Chemistry, 1985 , vol. 59, # 5-6 p. 613 - 620 |
|
~48%
dihexyl 9-ethyl... CAS#:105769-77-5 |
| Literature: Domanski, Andrzej; Kyziol, Janusz B. Polish Journal of Chemistry, 1985 , vol. 59, # 5-6 p. 613 - 620 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9H-Carbazole-3,6-dicarboxylic acid,9-ethyl-,dihexyl ester |