O-(3-methylbutyl) furan-2-carbonylsulfanylmethanethioate
Modify Date: 2025-11-30 16:47:59
O-(3-methylbutyl) furan-2-carbonylsulfanylmethanethioate structure
|
Common Name | O-(3-methylbutyl) furan-2-carbonylsulfanylmethanethioate | ||
|---|---|---|---|---|
| CAS Number | 105770-06-7 | Molecular Weight | 258.35700 | |
| Density | 1.218g/cm3 | Boiling Point | 336.5ºC at 760mmHg | |
| Molecular Formula | C11H14O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.3ºC | |
| Name | O-(3-methylbutyl) furan-2-carbonylsulfanylmethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 336.5ºC at 760mmHg |
| Molecular Formula | C11H14O3S2 |
| Molecular Weight | 258.35700 |
| Flash Point | 157.3ºC |
| Exact Mass | 258.03800 |
| PSA | 96.83000 |
| LogP | 3.50060 |
| Vapour Pressure | 0.000111mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | NLAMTTGKVUXSGM-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=S)SC(=O)c1ccco1 |
| Carbonic acid,dithio-,anhydrosulfide with thio-2-furoic acid,O-isopentyl ester |