menthyl 3-(2-pyridylsulfinyl)acrylate structure
|
Common Name | menthyl 3-(2-pyridylsulfinyl)acrylate | ||
|---|---|---|---|---|
| CAS Number | 105802-70-8 | Molecular Weight | 335.46100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-pyridin-2-ylsulfinylprop-2-enoate |
|---|
| Molecular Formula | C18H25NO3S |
|---|---|
| Molecular Weight | 335.46100 |
| Exact Mass | 335.15600 |
| PSA | 75.47000 |
| LogP | 4.57260 |
| InChIKey | KCWWRYNVHIKIDU-ZFFGRMDGSA-N |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C=CS(=O)c2ccccn2)C1 |
|
~%
menthyl 3-(2-py... CAS#:105802-70-8 |
| Literature: Takayama, Hiromitsu; Iyobe, Akira; Koizumi, Toru Journal of the Chemical Society, Chemical Communications, 1986 , # 10 p. 771 - 772 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |