4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester
Modify Date: 2026-06-29 16:38:59
4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester structure
|
Common Name | 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1058159-87-7 | Molecular Weight | 228.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20O3Si |
|---|---|
| Molecular Weight | 228.36000 |
| Exact Mass | 228.11800 |
| PSA | 35.53000 |
| LogP | 2.18300 |
| InChIKey | MLGCIYJRQFNXTJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C#CC(C)(C)O[Si](C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:345908-52-3
CAS#:72601-11-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: Molecular weight of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is 228.36000. |
| Q: What is the InChIKey of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: InChIKey of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is MLGCIYJRQFNXTJ-UHFFFAOYSA-N. |
| Q: What are the downstream products of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: Related downstream products(CAS) of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester: 345908-52-3;72601-11-7. |
| Q: What is the SMILES notation of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: SMILES notation of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is CCOC(=O)C#CC(C)(C)O[Si](C)(C)C. |
| Q: What is the LogP of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: LogP of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is 2.18300. |
| Q: What is the CAS number of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: CAS number of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is 1058159-87-7. |
| Q: What is the Chinese name of 1058159-87-7? |
| A: Chinese name of 1058159-87-7 is 1058159-87-7. |
| Q: What is the polar surface area (PSA) of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: Polar surface area (PSA) of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is 35.53000. |
| Q: What is the molecular formula of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: Molecular formula of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is C11H20O3Si. |
| Q: What is the English name of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester? |
| A: The English name of 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester is 4-methyl-4-trimethylsilanyloxy-pent-2-ynoic acid ethyl ester. |