2,8-dibromooxanthrene structure
|
Common Name | 2,8-dibromooxanthrene | ||
|---|---|---|---|---|
| CAS Number | 105836-96-2 | Molecular Weight | 341.98300 | |
| Density | 1.894g/cm3 | Boiling Point | 376.6ºC at 760mmHg | |
| Molecular Formula | C12H6Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.5ºC | |
| Name | 2,8-dibromodibenzo-p-dioxin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.894g/cm3 |
|---|---|
| Boiling Point | 376.6ºC at 760mmHg |
| Molecular Formula | C12H6Br2O2 |
| Molecular Weight | 341.98300 |
| Flash Point | 154.5ºC |
| Exact Mass | 339.87300 |
| PSA | 18.46000 |
| LogP | 5.10960 |
| Vapour Pressure | 1.55E-05mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | DSECKYFAHOXKDM-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c(c1)Oc1cc(Br)ccc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,8-DIBROMODIBENZO-PARA-DIOXIN |
| 2,8-Dibromooxanthrene |
| 2,8-dibromobenzo<b,e><1,4>dioxin |