2,2-diphenyl-1,3-thiazolidin-4-one structure
|
Common Name | 2,2-diphenyl-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 105855-53-6 | Molecular Weight | 255.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-diphenyl-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13NOS |
|---|---|
| Molecular Weight | 255.33500 |
| Exact Mass | 255.07200 |
| PSA | 57.89000 |
| LogP | 3.02660 |
| InChIKey | SXJUCSYTWQYASV-UHFFFAOYSA-N |
| SMILES | O=C1CSC(c2ccccc2)(c2ccccc2)N1 |
|
~57%
2,2-diphenyl-1,... CAS#:105855-53-6 |
| Literature: Younes; El-Zohry; Metwally 1986 , vol. 41, # 1 p. 134 - 135 |
|
~%
2,2-diphenyl-1,... CAS#:105855-53-6 |
| Literature: Davies; Ramsay; Stove Journal of the Chemical Society, 1949 , p. 2633,2636 |
| 4-Thiazolidinone,2,2-diphenyl |
| 2,2-Diphenyl-thiazolidin-4-on |
| 2,2-diphenylthiazolidin-4-one |
| 2,2-Diphenylthiazolid-4-one |