[2-(4-ethoxyanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate structure
|
Common Name | [2-(4-ethoxyanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 105858-92-2 | Molecular Weight | 415.61500 | |
| Density | 1.1g/cm3 | Boiling Point | 559.7ºC at 760mmHg | |
| Molecular Formula | C22H29N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.3ºC | |
| Name | [2-(4-ethoxyanilino)-2-(4-methylphenyl)iminoethyl] N,N-diethylcarbamodithioate |
|---|
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 559.7ºC at 760mmHg |
| Molecular Formula | C22H29N3OS2 |
| Molecular Weight | 415.61500 |
| Flash Point | 292.3ºC |
| Exact Mass | 415.17500 |
| PSA | 94.25000 |
| LogP | 5.96870 |
| Vapour Pressure | 1.47E-12mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | SLBDYHWIYUUPTA-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(CSC(=S)N(CC)CC)=Nc2ccc(C)cc2)cc1 |
|
~41%
[2-(4-ethoxyani... CAS#:105858-92-2 |
| Literature: Pantev, Totyu P Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 720 - 721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |