1-(2,4-difluorophenyl)-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid structure
|
Common Name | 1-(2,4-difluorophenyl)-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 105859-17-4 | Molecular Weight | 421.34500 | |
| Density | 1.522g/cm3 | Boiling Point | 600.4ºC at 760mmHg | |
| Molecular Formula | C20H15F4N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.9ºC | |
| Name | 1-(2,4-difluorophenyl)-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
|---|
| Density | 1.522g/cm3 |
|---|---|
| Boiling Point | 600.4ºC at 760mmHg |
| Molecular Formula | C20H15F4N3O3 |
| Molecular Weight | 421.34500 |
| Flash Point | 316.9ºC |
| Exact Mass | 421.10500 |
| PSA | 74.57000 |
| LogP | 3.04870 |
| Vapour Pressure | 2.89E-15mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | SOOLNUOIXZEEPO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cn(-c2ccc(F)cc2F)c2c(F)c(N3CCNCC3)c(F)cc2c1=O |
|
~45%
1-(2,4-difluoro... CAS#:105859-17-4 |
| Literature: Chu, Daniel T. W.; Fernandes, Prabhavathi B.; Maleczka, Robert E.; Nordeen, Carl W.; Pernet, Andre G. Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 504 - 509 |
|
~%
1-(2,4-difluoro... CAS#:105859-17-4 |
| Literature: Chu, Daniel T. W.; Fernandes, Prabhavathi B.; Maleczka, Robert E.; Nordeen, Carl W.; Pernet, Andre G. Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 504 - 509 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |