5-acetyl-1-benzyl-4-methyl-3,4-dihydro-1,5-benzodiazepin-2-one structure
|
Common Name | 5-acetyl-1-benzyl-4-methyl-3,4-dihydro-1,5-benzodiazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 105931-87-1 | Molecular Weight | 308.37400 | |
| Density | 1.176g/cm3 | Boiling Point | 595.4ºC at 760mmHg | |
| Molecular Formula | C19H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.3ºC | |
| Name | 5-acetyl-1-benzyl-4-methyl-3,4-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 595.4ºC at 760mmHg |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.37400 |
| Flash Point | 290.3ºC |
| Exact Mass | 308.15200 |
| PSA | 40.62000 |
| LogP | 3.49490 |
| Vapour Pressure | 3.83E-14mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | KGQYMZVRKCXZFR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1c2ccccc2N(Cc2ccccc2)C(=O)CC1C |
|
~69%
5-acetyl-1-benz... CAS#:105931-87-1 |
| Literature: Chemistry of Heterocyclic Compounds (New York, NY, United States), , vol. 22, # 2 p. 206 - 210 Khimiya Geterotsiklicheskikh Soedinenii, , vol. 22, # 2 p. 254 - 258 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS666G19 |
| 1-benzyl-4-methyl-5-acetyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-2-one |