2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7H-purin-6-one
Modify Date: 2024-04-07 10:09:29
![2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7H-purin-6-one Structure](https://image.chemsrc.com/caspic/221/105970-04-5.png)
2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7H-purin-6-one structure
|
Common Name | 2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 105970-04-5 | Molecular Weight | 275.26300 | |
| Density | 1.65g/cm3 | Boiling Point | 658.6ºC at 760mmHg | |
| Molecular Formula | C12H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.1ºC | |
| Name | 2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 658.6ºC at 760mmHg |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.26300 |
| Flash Point | 352.1ºC |
| Exact Mass | 275.10200 |
| PSA | 116.62000 |
| Vapour Pressure | 3.22E-17mmHg at 25°C |
| Index of Refraction | 1.758 |
| InChIKey | WJSVJNDMOQTICG-UHFFFAOYSA-N |
| SMILES | C=C1CC(C)(Cn2c(N)nc3nc[nH]c3c2=O)OC1=O |
|
~%
2-amino-1-[(2-m... CAS#:105970-04-5 |
| Literature: Lee, Kuo-Hsiung; Rice, Gregory K.; Hall, Iris H.; Amarnath, Venkataraman Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 586 - 588 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Guanine derivative |
| 1-Mmofg |