2-bromo-5-methyl-4-nitro-1H-imidazole structure
|
Common Name | 2-bromo-5-methyl-4-nitro-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 105983-46-8 | Molecular Weight | 205.99700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H4BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5-methyl-4-nitro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H4BrN3O2 |
|---|---|
| Molecular Weight | 205.99700 |
| Exact Mass | 204.94900 |
| PSA | 74.50000 |
| LogP | 1.91200 |
| InChIKey | GOKBPGXXQSCLLS-UHFFFAOYSA-N |
| SMILES | Cc1nc(Br)[nH]c1[N+](=O)[O-] |
|
~%
2-bromo-5-methy... CAS#:105983-46-8 |
| Literature: Windaus Chemische Berichte, 1909 , vol. 42, p. 761 |
|
~%
2-bromo-5-methy... CAS#:105983-46-8 |
| Literature: Pyman; Timmis Journal of the Chemical Society, 1923 , vol. 123, p. 501 |
|
~%
2-bromo-5-methy... CAS#:105983-46-8 |
| Literature: Windaus Chemische Berichte, 1909 , vol. 42, p. 761 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Imidazole,2-bromo-4-methyl-5-nitro |
| 2-Bromo-4-methyl-5-nitro-1H-imidazole |
| 1H-Imidazole,2-bromo-4-methyl-5-nitro |