methyl 2-[dimethyl(phenyl)silyl]-2-methylbut-3-enoate structure
|
Common Name | methyl 2-[dimethyl(phenyl)silyl]-2-methylbut-3-enoate | ||
|---|---|---|---|---|
| CAS Number | 106046-48-4 | Molecular Weight | 248.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[dimethyl(phenyl)silyl]-2-methylbut-3-enoate |
|---|
| Molecular Formula | C14H20O2Si |
|---|---|
| Molecular Weight | 248.39300 |
| Exact Mass | 248.12300 |
| PSA | 26.30000 |
| LogP | 2.72130 |
| InChIKey | XFRKHXUIJRQJGQ-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C(=O)OC)[Si](C)(C)c1ccccc1 |
|
~%
methyl 2-[dimet... CAS#:106046-48-4 |
| Literature: Uno, Hidemitsu Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 8 p. 2471 - 2480 |
|
~%
methyl 2-[dimet... CAS#:106046-48-4 |
| Literature: Uno, Hidemitsu Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 8 p. 2471 - 2480 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |