(Z)-4-phenyl-3-[2-(2-pyrrolidin-2-ylethoxy)phenoxy]but-3-en-2-one
Modify Date: 2025-09-20 17:58:38
![(Z)-4-phenyl-3-[2-(2-pyrrolidin-2-ylethoxy)phenoxy]but-3-en-2-one Structure](https://image.chemsrc.com/caspic/367/106063-88-1.png)
(Z)-4-phenyl-3-[2-(2-pyrrolidin-2-ylethoxy)phenoxy]but-3-en-2-one structure
|
Common Name | (Z)-4-phenyl-3-[2-(2-pyrrolidin-2-ylethoxy)phenoxy]but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 106063-88-1 | Molecular Weight | 351.43900 | |
| Density | 1.12g/cm3 | Boiling Point | 531.5ºC at 760 mmHg | |
| Molecular Formula | C22H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.3ºC | |
| Name | (Z)-4-phenyl-3-[2-(2-pyrrolidin-2-ylethoxy)phenoxy]but-3-en-2-one |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 531.5ºC at 760 mmHg |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.43900 |
| Flash Point | 275.3ºC |
| Exact Mass | 351.18300 |
| PSA | 47.56000 |
| LogP | 4.54520 |
| Vapour Pressure | 2.23E-11mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | XXBBFEGHAPROSP-JWGURIENSA-N |
| SMILES | CC(=O)C(=Cc1ccccc1)Oc1ccccc1OCCC1CCCN1 |
|
~%
(Z)-4-phenyl-3-... CAS#:106063-88-1 |
| Literature: Salimbeni, Aldo; Manghisi, Elso; Fregnan, Giancarlo B.; Prada, Marco Journal of Medicinal Chemistry, 1987 , vol. 30, # 5 p. 773 - 780 |
|
~%
(Z)-4-phenyl-3-... CAS#:106063-88-1 |
| Literature: Salimbeni, Aldo; Manghisi, Elso; Fregnan, Giancarlo B.; Prada, Marco Journal of Medicinal Chemistry, 1987 , vol. 30, # 5 p. 773 - 780 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |