(Z)-3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenoxy]-4-phenylbut-3-en-2-one structure
|
Common Name | (Z)-3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenoxy]-4-phenylbut-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 106064-00-0 | Molecular Weight | 383.48100 | |
| Density | 1.121g/cm3 | Boiling Point | 569ºC at 760 mmHg | |
| Molecular Formula | C23H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.9ºC | |
| Name | (Z)-3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenoxy]-4-phenylbut-3-en-2-one |
|---|
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 569ºC at 760 mmHg |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.48100 |
| Flash Point | 297.9ºC |
| Exact Mass | 383.21000 |
| PSA | 67.79000 |
| LogP | 4.21420 |
| Vapour Pressure | 8.77E-14mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | JHGZTFGLCONBSN-HMAPJEAMSA-N |
| SMILES | CC(=O)C(=Cc1ccccc1)Oc1ccccc1OCC(O)CNC(C)(C)C |
|
~%
(Z)-3-[2-[3-(te... CAS#:106064-00-0 |
| Literature: Salimbeni, Aldo; Manghisi, Elso; Fregnan, Giancarlo B.; Prada, Marco Journal of Medicinal Chemistry, 1987 , vol. 30, # 5 p. 773 - 780 |
|
~%
(Z)-3-[2-[3-(te... CAS#:106064-00-0 |
| Literature: Salimbeni, Aldo; Manghisi, Elso; Fregnan, Giancarlo B.; Prada, Marco Journal of Medicinal Chemistry, 1987 , vol. 30, # 5 p. 773 - 780 |
|
~%
(Z)-3-[2-[3-(te... CAS#:106064-00-0 |
| Literature: Salimbeni, Aldo; Manghisi, Elso; Fregnan, Giancarlo B.; Prada, Marco Journal of Medicinal Chemistry, 1987 , vol. 30, # 5 p. 773 - 780 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |