5-methyl-4-(3-methylbut-2-enyl)-2-benzofuran-1,3-dione structure
|
Common Name | 5-methyl-4-(3-methylbut-2-enyl)-2-benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 106113-17-1 | Molecular Weight | 230.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-4-(3-methylbut-2-enyl)-2-benzofuran-1,3-dione |
|---|
| Molecular Formula | C14H14O3 |
|---|---|
| Molecular Weight | 230.25900 |
| Exact Mass | 230.09400 |
| PSA | 43.37000 |
| LogP | 2.81430 |
| InChIKey | WDJQUZUFSOONQM-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(C)ccc2c1C(=O)OC2=O |
|
~93%
5-methyl-4-(3-m... CAS#:106113-17-1 |
| Literature: Ekkundi, Vadiraj S.; Trivedi, G. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 360 - 364 |
|
~%
5-methyl-4-(3-m... CAS#:106113-17-1 |
| Literature: Ekkundi, Vadiraj S.; Trivedi, G. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 360 - 364 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |