5-iodopent-1-ynyl-tri(propan-2-yl)silane structure
|
Common Name | 5-iodopent-1-ynyl-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 106130-92-1 | Molecular Weight | 350.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H27ISi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-iodopent-1-ynyl-tri(propan-2-yl)silane |
|---|
| Molecular Formula | C14H27ISi |
|---|---|
| Molecular Weight | 350.35400 |
| Exact Mass | 350.09300 |
| LogP | 5.42300 |
| InChIKey | ZOOIYOQMYFCIOA-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C#CCCCI)(C(C)C)C(C)C |
|
~91%
5-iodopent-1-yn... CAS#:106130-92-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1085 - 1094 |
|
~%
5-iodopent-1-yn... CAS#:106130-92-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1085 - 1094 |
|
~%
5-iodopent-1-yn... CAS#:106130-92-1 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1085 - 1094 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |