4-benzyl-1-(2-phenylethyl)piperazine-2,6-dione structure
|
Common Name | 4-benzyl-1-(2-phenylethyl)piperazine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 106148-27-0 | Molecular Weight | 308.37400 | |
| Density | 1.194g/cm3 | Boiling Point | 493.2ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.8ºC | |
| Name | 4-benzyl-1-(2-phenylethyl)piperazine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 493.2ºC at 760 mmHg |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.37400 |
| Flash Point | 220.8ºC |
| Exact Mass | 308.15200 |
| PSA | 40.62000 |
| LogP | 1.97590 |
| Vapour Pressure | 7.21E-10mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | FDHZQDHDJVZPMI-UHFFFAOYSA-N |
| SMILES | O=C1CN(Cc2ccccc2)CC(=O)N1CCc1ccccc1 |
|
~64%
4-benzyl-1-(2-p... CAS#:106148-27-0 |
| Literature: Yuste; Pallas; Barrios; et al. Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 1 p. 189 - 190 |
| 4-Benzyl-1-phenethyl-piperazine-2,6-dione |
| 4-benzyl-1-phenethyl-2,6-piperazinedione |
| HMS1607D12 |