2,2',3,4,4',6,6'-heptachlorodiphenyl ether structure
|
Common Name | 2,2',3,4,4',6,6'-heptachlorodiphenyl ether | ||
|---|---|---|---|---|
| CAS Number | 106220-84-2 | Molecular Weight | 411.32300 | |
| Density | 1.687g/cm3 | Boiling Point | 387.1ºC at 760mmHg | |
| Molecular Formula | C12H3Cl7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.5ºC | |
| Name | 1,2,3,5-tetrachloro-4-(2,4,6-trichlorophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.687g/cm3 |
|---|---|
| Boiling Point | 387.1ºC at 760mmHg |
| Molecular Formula | C12H3Cl7O |
| Molecular Weight | 411.32300 |
| Flash Point | 130.5ºC |
| Exact Mass | 407.80000 |
| PSA | 9.23000 |
| LogP | 8.05270 |
| Vapour Pressure | 7.51E-06mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | WTYSJAGEYAAIFW-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(Oc2c(Cl)cc(Cl)c(Cl)c2Cl)c(Cl)c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2-Hpcde |
| 2,2',3,4,4',6,6'-Heptachlorodiphenyl ether |
| 2,2',3,4,4',6,6'-heptachlorobiphenyl ether |