[2-(dimethylamino)-2-oxoethyl] benzoate structure
|
Common Name | [2-(dimethylamino)-2-oxoethyl] benzoate | ||
|---|---|---|---|---|
| CAS Number | 106231-54-3 | Molecular Weight | 207.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(dimethylamino)-2-oxoethyl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3 |
|---|---|
| Molecular Weight | 207.22600 |
| Exact Mass | 207.09000 |
| PSA | 46.61000 |
| LogP | 0.93160 |
| InChIKey | WKIMLEWQZUKSJM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC(=O)c1ccccc1 |
|
~86%
[2-(dimethylami... CAS#:106231-54-3 |
| Literature: Nielsen; Bundgaard Journal of pharmaceutical sciences, 1988 , vol. 77, # 4 p. 285 - 298 |
|
~%
[2-(dimethylami... CAS#:106231-54-3 |
| Literature: Bundgaard, Hans; Nielsen, Niels Mork Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 451 - 454 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| Benzoic acid dimethylcarbamoylmethyl ester |