(2-acetylphenyl) benzenesulfonate structure
|
Common Name | (2-acetylphenyl) benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 106276-56-6 | Molecular Weight | 276.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-acetylphenyl) benzenesulfonate |
|---|
| Molecular Formula | C14H12O4S |
|---|---|
| Molecular Weight | 276.30800 |
| Exact Mass | 276.04600 |
| PSA | 68.82000 |
| LogP | 3.73770 |
| InChIKey | VPDVFOVDHKIUSC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1OS(=O)(=O)c1ccccc1 |
|
~%
(2-acetylphenyl... CAS#:106276-56-6 |
| Literature: Philbin et al. Journal of the Chemical Society, 1956 , p. 4414,4416 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |