2-chloro-N-(diethylcarbamoylmethyl)-N-phenyl-acetamide structure
|
Common Name | 2-chloro-N-(diethylcarbamoylmethyl)-N-phenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 106321-35-1 | Molecular Weight | 282.76600 | |
| Density | 1.181g/cm3 | Boiling Point | 409.9ºC at 760mmHg | |
| Molecular Formula | C14H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 2-(N-(2-chloroacetyl)anilino)-N,N-diethylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760mmHg |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.76600 |
| Flash Point | 201.7ºC |
| Exact Mass | 282.11400 |
| PSA | 40.62000 |
| LogP | 2.12680 |
| Vapour Pressure | 6.29E-07mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | JYLLMBJNBRRGGA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)CN(C(=O)CCl)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Chloracetyl-N-phenyl-glycin-diaethylamid |
| N-chloroacetyl-N-phenyl-glycine diethylamide |
| GB-115 |