343TRINITROBIPHENYL structure
|
Common Name | 343TRINITROBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 106323-83-5 | Molecular Weight | 289.20000 | |
| Density | 1.52g/cm3 | Boiling Point | 502.7ºC at 760 mmHg | |
| Molecular Formula | C12H7N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.2ºC | |
| Name | 1,2-dinitro-4-(3-nitrophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 502.7ºC at 760 mmHg |
| Molecular Formula | C12H7N3O6 |
| Molecular Weight | 289.20000 |
| Flash Point | 257.2ºC |
| Exact Mass | 289.03300 |
| PSA | 137.46000 |
| LogP | 4.64780 |
| Vapour Pressure | 9.69E-10mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | XEAAGZOUMUJBTD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)c1 |
| HS Code | 2904209090 |
|---|
|
~%
343TRINITROBIPHENYL CAS#:106323-83-5 |
| Literature: Case Journal of the American Chemical Society, 1942 , vol. 64, p. 2225 |
|
~%
343TRINITROBIPHENYL CAS#:106323-83-5 |
| Literature: Case Journal of the American Chemical Society, 1942 , vol. 64, p. 2225 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3,4,3'-Trinitrobiphenyl |
| 1,1'-BIPHENYL,3,3',4-TRINITRO |