Methyl 2-oxo-2,3-dihydro-1H-1,3-benzimidazole-5-carboxylate structure
|
Common Name | Methyl 2-oxo-2,3-dihydro-1H-1,3-benzimidazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 106429-57-6 | Molecular Weight | 192.17100 | |
| Density | 1.325g/cm3 | Boiling Point | 221.2ºC at 760mmHg | |
| Molecular Formula | C9H8N2O3 | Melting Point | 312-313ºC | |
| MSDS | N/A | Flash Point | 87.6ºC | |
| Name | Methyl 2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 221.2ºC at 760mmHg |
| Melting Point | 312-313ºC |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17100 |
| Flash Point | 87.6ºC |
| Exact Mass | 192.05300 |
| PSA | 74.95000 |
| LogP | 0.64280 |
| Vapour Pressure | 0.109mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | KZBROPAHLBJQQC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
|
~92%
Methyl 2-oxo-2,... CAS#:106429-57-6 |
| Literature: WO2009/134750 A1, ; Page/Page column 139 ; |
|
~%
Methyl 2-oxo-2,... CAS#:106429-57-6 |
| Literature: WO2005/60967 A1, ; Page/Page column 16 ; WO 2005/060967 A1 |
|
~%
Methyl 2-oxo-2,... CAS#:106429-57-6 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 291, p. 327 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| Methyl 2-oxo-2,3-dihydro-1H-1,3-benzimidazole-5-carboxylate |