Dicatenarin
Modify Date: 2025-09-12 22:27:00
Dicatenarin structure
|
Common Name | Dicatenarin | ||
|---|---|---|---|---|
| CAS Number | 1065-08-3 | Molecular Weight | 570.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H18O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dicatenarin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H18O12 |
|---|---|
| Molecular Weight | 570.5 |
| InChIKey | UJQQRKKOXCGWSR-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c2c(c1O)C(=O)c1c(c(O)cc(O)c1-c1c(O)cc(O)c3c1C(=O)c1c(O)c(C)cc(O)c1C3=O)C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1065-08-3? |
| A: Chinese name of 1065-08-3 is 1065-08-3. |
| Q: What is the InChIKey of Dicatenarin? |
| A: InChIKey of Dicatenarin is UJQQRKKOXCGWSR-UHFFFAOYSA-N. |
| Q: What is the English name of Dicatenarin? |
| A: The English name of Dicatenarin is Dicatenarin. |
| Q: What is the molecular formula of Dicatenarin? |
| A: Molecular formula of Dicatenarin is C30H18O12. |
| Q: What is the molecular weight of Dicatenarin? |
| A: Molecular weight of Dicatenarin is 570.5. |
| Q: What is the SMILES notation of Dicatenarin? |
| A: SMILES notation of Dicatenarin is Cc1cc(O)c2c(c1O)C(=O)c1c(c(O)cc(O)c1-c1c(O)cc(O)c3c1C(=O)c1c(O)c(C)cc(O)c1C3=O)C2=O. |
| Q: What is the CAS number of Dicatenarin? |
| A: CAS number of Dicatenarin is 1065-08-3. |