1-(6-methoxy-1,3-benzothiazol-2-yl)-3,4-dimethylpyrano[2,3-c]pyrazol-6-one structure
|
Common Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3,4-dimethylpyrano[2,3-c]pyrazol-6-one | ||
|---|---|---|---|---|
| CAS Number | 106515-43-9 | Molecular Weight | 327.35800 | |
| Density | 1.49g/cm3 | Boiling Point | 574.6ºC at 760mmHg | |
| Molecular Formula | C16H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.3ºC | |
| Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3,4-dimethylpyrano[2,3-c]pyrazol-6-one |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 574.6ºC at 760mmHg |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.35800 |
| Flash Point | 301.3ºC |
| Exact Mass | 327.06800 |
| PSA | 98.39000 |
| LogP | 3.21380 |
| Vapour Pressure | 3.31E-13mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | DUXGSDBLHAOHTE-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(-n3nc(C)c4c(C)cc(=O)oc43)sc2c1 |
|
~%
1-(6-methoxy-1,... CAS#:106515-43-9 |
| Literature: Vaid, R. K.; Dhindsa, G. S.; Kaushik, B.; Singh, S. P.; Dhawan, S. N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 569 - 570 |
|
~%
1-(6-methoxy-1,... CAS#:106515-43-9 |
| Literature: Vaid, Radhe K.; Dhindsa, Gurnam S.; Kaushik, Beena; Singh, Shiv P. Organic Mass Spectrometry, 1987 , vol. 22, p. 36 - 38 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |