2-[4-[1-(4-fluorophenyl)-5-(trifluoromethyl)indol-3-yl]piperazin-1-yl]ethanol structure
|
Common Name | 2-[4-[1-(4-fluorophenyl)-5-(trifluoromethyl)indol-3-yl]piperazin-1-yl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 106516-68-1 | Molecular Weight | 407.40500 | |
| Density | 1.34g/cm3 | Boiling Point | 524.4ºC at 760 mmHg | |
| Molecular Formula | C21H21F4N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271ºC | |
| Name | 2-[4-[1-(4-fluorophenyl)-5-(trifluoromethyl)indol-3-yl]piperazin-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 524.4ºC at 760 mmHg |
| Molecular Formula | C21H21F4N3O |
| Molecular Weight | 407.40500 |
| Flash Point | 271ºC |
| Exact Mass | 407.16200 |
| PSA | 31.64000 |
| LogP | 3.90560 |
| Vapour Pressure | 7.97E-12mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | NCZRXRGIUPSHIH-UHFFFAOYSA-N |
| SMILES | OCCN1CCN(c2cn(-c3ccc(F)cc3)c3ccc(C(F)(F)F)cc23)CC1 |
|
~%
2-[4-[1-(4-fluo... CAS#:106516-68-1 |
| Literature: Perregaard; Arnt; Bogeso; Hyttel; Sanchez Journal of Medicinal Chemistry, 1992 , vol. 35, # 6 p. 1092 - 1101 |
| Lu 21-152 |