3-(4-bromoanilino)-5,5-dimethylcyclohex-2-en-1-one structure
|
Common Name | 3-(4-bromoanilino)-5,5-dimethylcyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 106518-84-7 | Molecular Weight | 294.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-bromoanilino)-5,5-dimethylcyclohex-2-en-1-one |
|---|
| Molecular Formula | C14H16BrNO |
|---|---|
| Molecular Weight | 294.18700 |
| Exact Mass | 293.04200 |
| PSA | 29.10000 |
| LogP | 4.20700 |
| InChIKey | XIOHTTFVDXJURY-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C=C(Nc2ccc(Br)cc2)C1 |
|
~93%
3-(4-bromoanili... CAS#:106518-84-7 |
| Literature: Journal of the Iranian Chemical Society, , vol. 7, # 1 p. 69 - 76 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |