7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane
Modify Date: 2025-09-01 17:14:21
![7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane Structure](https://www.chemsrc.com/extcaspic/464/1065183-18-7.png)
7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane structure
|
Common Name | 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 1065183-18-7 | Molecular Weight | 236.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O2S |
|---|---|
| Molecular Weight | 236.33 |
| InChIKey | AMPOORWZGBHTDR-UHFFFAOYSA-N |
| SMILES | c1ccc(C2CC3(CCS2)OCCO3)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1065183-18-7? |
| A: Chinese name of 1065183-18-7 is 1065183-18-7. |
| Q: What is the InChIKey of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane? |
| A: InChIKey of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is AMPOORWZGBHTDR-UHFFFAOYSA-N. |
| Q: What is the English name of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane? |
| A: The English name of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane. |
| Q: What is the molecular formula of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane? |
| A: Molecular formula of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is C13H16O2S. |
| Q: What is the SMILES notation of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane? |
| A: SMILES notation of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is c1ccc(C2CC3(CCS2)OCCO3)cc1. |
| Q: What is the CAS number of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane? |
| A: CAS number of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is 1065183-18-7. |
| Q: What is the molecular weight of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane? |
| A: Molecular weight of 7-Phenyl-1,4-dioxa-8-thiaspiro[4.5]decane is 236.33. |